For research use only. Not for therapeutic Use.
(±)12-HETE (12-Hydroxy-5,8,10,14-eicosatetraenoic acid) (Cat No.: R067261) is a bioactive lipid mediator formed from arachidonic acid through the action of 12-lipoxygenase enzymes. It plays a key role in regulating inflammation, immune response, and vascular function. (±)12-HETE is involved in various physiological processes, including cell signaling, angiogenesis, and platelet aggregation. It has been implicated in several diseases, such as cancer, cardiovascular disorders, and inflammatory conditions. Research continues to explore its potential as a therapeutic target for these diseases.
| Catalog Number | R067261 |
| CAS Number | 71030-37-0 |
| Synonyms | (±)12-hydroxy-5Z,8Z,10E,14Z-eicosatetraenoic acid |
| Molecular Formula | C20H32O3 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | (5Z,8Z,10E,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoic acid |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h7-11,13-14,17,19,21H,2-6,12,15-16,18H2,1H3,(H,22,23)/b9-7-,11-8-,13-10-,17-14+ |
| InChIKey | ZNHVWPKMFKADKW-VXBMJZGYSA-N |
| SMILES | CCCCCC=CCC(C=CC=CCC=CCCCC(=O)O)O |
| Reference |
|
