For research use only. Not for therapeutic Use.
(±)-2-Aminohexane-d6 is a deuterated analog of 2-Aminohexane, used in advanced pharmaceutical and biochemical research. This isotopically labeled compound aids in the precise study of metabolic pathways, drug interactions, and chemical reactions. Its stable isotope labeling ensures accurate mass spectrometry and NMR analysis, providing reliable and reproducible data. Ideal for research on central nervous system stimulants, drug development, and organic synthesis, (±)-2-Aminohexane-d6 enhances the understanding of its chemical behavior and potential applications, making it indispensable for innovative scientific investigations.
| Catalog Number | M089958 |
| CAS Number | 1219802-28-4 |
| Synonyms | (±)-2-AMinohexane–d6 |
| Molecular Formula | C6H15N |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 1,1,1,2,3,3-hexadeuteriohexan-2-amine |
| InChI | InChI=1S/C6H15N/c1-3-4-5-6(2)7/h6H,3-5,7H2,1-2H3/i2D3,5D2,6D |
| InChIKey | WGBBUURBHXLGFM-LOSVJEASSA-N |
| SMILES | CCCCC(C)N |
