For research use only. Not for therapeutic Use.
(±)9(10)-DiHOME-d4 is a deuterium-labeled derivative of 9(10)-DiHOME, a fatty acid metabolite involved in lipid signaling pathways. This compound targets peroxisome proliferator-activated receptors (PPARs) and is used in research to investigate its role in metabolic regulation, inflammation, and cardiovascular health. The deuterium labeling allows for detailed studies using mass spectrometry, providing accurate quantification and metabolic profiling. Its applications span pharmaceutical, organic, and nutritional chemistry, aiding in the development of therapeutic strategies for metabolic disorders and enhancing the understanding of lipid biochemistry.
| Catalog Number | R030078 |
| Synonyms | Leukotoxin diol-d4 |
| Molecular Formula | C18H30D4O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (Z)-9,10,12,13-tetradeuterio-9,10-dihydroxyoctadec-12-enoic acid |
| InChI | InChI=1S/C18H34O4/c1-2-3-4-5-7-10-13-16(19)17(20)14-11-8-6-9-12-15-18(21)22/h7,10,16-17,19-20H,2-6,8-9,11-15H2,1H3,(H,21,22)/b10-7-/t16-,17+/m1/s1/i7D,10D,16D,17D |
| InChIKey | XEBKSQSGNGRGDW-NPOMILTLSA-N |
| SMILES | [2H]/C(=C(\[2H])/CC([2H])(C([2H])(CCCCCCCC(=O)O)O)O)/CCCCC |
| Reference | 1.Hayakawa, M.,Sugiyama, S.,Takamura, T., et al. Neutrophils biosynthesize leukotoxin, 9,10-epoxy-12-octadecenoate. Biochemical and Biophysical Research Communications 137, 424-430 (1986). |
