For research use only. Not for therapeutic Use.
(±)9-HpODE（Cat No.:R029900）is a versatile lipid peroxidation product, formed from the oxidation of linoleic acid. As a 9-hydroxy derivative of octadecadienoic acid, it plays a crucial role in cell signaling, particularly in oxidative stress and inflammation. This compound is widely studied for its impact on membrane lipid peroxidation, immune responses, and its potential implications in cardiovascular diseases, cancer, and neurodegenerative disorders. (±)9-HpODE serves as a biomarker for oxidative damage and a valuable tool in research on oxidative stress-related diseases and therapeutic interventions targeting lipid peroxidation pathways.
| Catalog Number | R029900 |
| CAS Number | 5502-91-0 |
| Synonyms | (±)9-hydroperoxy-10E,12Z-octadecadienoic acid |
| Molecular Formula | C18H32O4 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -80°C |
| IUPAC Name | (10E,12Z)-9-hydroperoxyoctadeca-10,12-dienoic acid |
| InChI | InChI=1S/C18H32O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h6,8,11,14,17,21H,2-5,7,9-10,12-13,15-16H2,1H3,(H,19,20)/b8-6-,14-11+ |
| InChIKey | JGUNZIWGNMQSBM-ZJHFMPGASA-N |
| SMILES | CCCCC/C=C\C=C\C(CCCCCCCC(=O)O)OO |
