For research use only. Not for therapeutic Use.
(±)-Cryptone(Cat No.:R034269)is a naturally occurring monoterpene ketone found in various essential oils, particularly in eucalyptus and other aromatic plants. Known for its distinctive minty aroma, it is used extensively in the fragrance and flavor industries. Cryptone exhibits potential therapeutic properties, including antimicrobial and anti-inflammatory activities, making it valuable in traditional and modern medicine. Its chemical structure allows for diverse applications in organic synthesis and as an intermediate in producing other complex compounds. The versatility and bioactivity of (±)-Cryptone underscore its significance in both commercial and medicinal contexts.
CAS Number | 500-02-7 |
Synonyms | 4-(1-Methylethyl)-2-cyclohexen-1-one; 4-Isopropyl-2-cyclohexen-1-one; 4-Isopropyl-2-cyclohexenone; Crypton; DL-Kryptone; NSC 22060 |
Molecular Formula | C9H14O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-propan-2-ylcyclohex-2-en-1-one |
InChI | InChI=1S/C9H14O/c1-7(2)8-3-5-9(10)6-4-8/h3,5,7-8H,4,6H2,1-2H3 |
InChIKey | AANMVENRNJYEMK-UHFFFAOYSA-N |
SMILES | CC(C)C1CCC(=O)C=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |