For research use only. Not for therapeutic Use.
(±)-Hexanoylcarnitine chloride(Cat No.:I010228)is a synthetic derivative of carnitine, a compound involved in fatty acid metabolism. This molecule is primarily studied for its role in cellular energy production, as it facilitates the transport of fatty acids into mitochondria for oxidation. (±)-Hexanoylcarnitine chloride is used in research to explore metabolic pathways, particularly in relation to mitochondrial function and disorders associated with energy production deficiencies. Its potential applications include understanding metabolic diseases, obesity, and conditions related to impaired fatty acid metabolism, making it a valuable tool in biochemical and pharmacological studies.
CAS Number | 6920-35-0 |
Synonyms | (3-carboxy-2-hexanoyloxypropyl)-trimethylazanium;chloride |
Molecular Formula | C13H26ClNO4 |
Purity | ≥95% |
IUPAC Name | (3-carboxy-2-hexanoyloxypropyl)-trimethylazanium;chloride |
InChI | InChI=1S/C13H25NO4.ClH/c1-5-6-7-8-13(17)18-11(9-12(15)16)10-14(2,3)4;/h11H,5-10H2,1-4H3;1H |
InChIKey | DTHGTKVOSRYXOK-UHFFFAOYSA-N |
SMILES | CCCCCC(=O)OC(CC(=O)O)C[N+](C)(C)C.[Cl-] |