For research use only. Not for therapeutic Use.
(±)-Leucine-d10(Cat No.:S000606) is an isotopically labeled form of leucine, a crucial amino acid essential for protein synthesis and various physiological processes in the body. The “d10” designation indicates that all 10 hydrogen atoms in the molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic substitution enables researchers to track leucine’s metabolic fate and incorporation into proteins with greater precision using techniques like mass spectrometry. Such isotopically labeled compounds play a vital role in metabolic studies, elucidating pathways, and understanding biological processes at a molecular level.
CAS Number | 29909-01-1 |
Molecular Formula | C6H3D10NO2 |
Purity | ≥95% |
Target | Anti-infection |
IUPAC Name | 2-amino-2,3,3,4,5,5,5-heptadeuterio-4-(trideuteriomethyl)pentanoic acid |
InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/i1D3,2D3,3D2,4D,5D |
InChIKey | ROHFNLRQFUQHCH-SHJFKSRGSA-N |
SMILES | CC(C)CC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |