For research use only. Not for therapeutic Use.
(±)-Lisofylline-d6（Cat No.:S000541） is a deuterated form of lisofylline, where six hydrogen atoms are replaced with deuterium. Lisofylline, a chiral molecule, has been studied for its potential to reduce inflammation and improve cellular metabolic regulation. It is particularly noted for its effects in mitigating complications from conditions like acute respiratory distress syndrome (ARDS) and diabetes. The introduction of deuterium in (±)-lisofylline-d6 enhances its chemical stability, making it especially useful for detailed pharmacokinetic and metabolic studies. This information is crucial for understanding the drug’s behavior in the body, aiming to optimize its therapeutic use and reduce potential side effects.
| Catalog Number | S000541 |
| CAS Number | 1185995-26-9 |
| Molecular Formula | C13H14D6N4O3 |
| Purity | ≥95% |
| IUPAC Name | 1-(5-hydroxyhexyl)-3,7-bis(trideuteriomethyl)purine-2,6-dione |
| InChI | InChI=1S/C13H20N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8-9,18H,4-7H2,1-3H3/i2D3,3D3 |
| InChIKey | NSMXQKNUPPXBRG-XERRXZQWSA-N |
| SMILES | CC(CCCCN1C(=O)C2=C(N=CN2C)N(C1=O)C)O |
