For research use only. Not for therapeutic Use.
(±)-Naproxen-d3 is the deuterium labeled (±)-Naproxen. (±)-Naproxen is a non-steroidal anti-inflammatory drug (NSAID)[1].
| Catalog Number | I045073 |
| CAS Number | 958293-79-3 |
| Synonyms | 2-[6-(trideuteriomethoxy)naphthalen-2-yl]propanoic acid |
| Molecular Formula | C14H11D3O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16)/i2D3 |
| InChIKey | CMWTZPSULFXXJA-BMSJAHLVSA-N |
| SMILES | CC(C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)O |
| Reference | [1]. Brogden RN, et, al. Naproxen: a review of its pharmacological properties and therapeutic efficacy and use. Drugs. 1975;9(5):326-63. |
