For research use only. Not for therapeutic Use.
(±)-Panduratin A(Cat No.:R026933)is a natural chalcone derivative isolated from the rhizomes of Boesenbergia rotunda, known for its potent bioactive properties. It exhibits significant anti-inflammatory, antioxidant, and anticancer activities, making it a valuable compound in pharmaceutical research. (±)-Panduratin A has been studied for its ability to inhibit key enzymes and signaling pathways involved in inflammation and tumor growth, offering potential therapeutic applications in conditions such as cancer, cardiovascular diseases, and metabolic disorders. Its broad spectrum of biological effects makes it a promising candidate for drug development.
Catalog Number | R026933 |
CAS Number | 89837-52-5 |
Synonyms | rel-2,6-Dihydroxy-4-methoxyphenyl)[(1R,2S,6R)-3-methyl-2-(3-methyl-2-buten-1-yl)-6-phenyl-3-cyclohexen-1-yl]-methanone; (1α,2α,6β)-(±)-2,6-Dihydroxy-4-methoxyphenyl)[(1R,2S,6R)-3-methyl-2-(3-methyl-2-buten-1-yl)-6-phenyl-3-cyclohexen-1-yl]-methanone; |
Molecular Formula | C26H30O4 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | (2,6-dihydroxy-4-methoxyphenyl)-[(1R,2S,6R)-3-methyl-2-(3-methylbut-2-enyl)-6-phenylcyclohex-3-en-1-yl]methanone |
InChI | InChI=1S/C26H30O4/c1-16(2)10-12-20-17(3)11-13-21(18-8-6-5-7-9-18)24(20)26(29)25-22(27)14-19(30-4)15-23(25)28/h5-11,14-15,20-21,24,27-28H,12-13H2,1-4H3/t20-,21+,24-/m1/s1 |
InChIKey | LYDZCXVWCFJAKQ-ZFGGDYGUSA-N |
SMILES | CC1=CCC(C(C1CC=C(C)C)C(=O)C2=C(C=C(C=C2O)OC)O)C3=CC=CC=C3 |