For research use only. Not for therapeutic Use.
(±)-Paraconic Acid(Cat No.:R032918)is a chiral compound often used in chemical and pharmaceutical research. As a lactone, it features a cyclic ester structure, making it valuable in studying ring-opening reactions and stereochemistry. This compound is employed as a building block in the synthesis of complex molecules and natural product derivatives. Its dual enantiomeric forms provide insights into chiral interactions and biological activity, making (±)-Paraconic Acid a key substance in developing new drugs and exploring biochemical pathways.
CAS Number | 498-89-5 |
Synonyms | Tetrahydro-5-oxo-3-furoic Acid; (Hydroxymethyl)succinic Acid γ-Lactone; Tetrahydro-5-oxo-3-furancarboxylic Acid; 5-Oxotetrahydro-3-furancarboxylic Acid; (Hydroxymethyl)butanedioic Acid γ-Lactone; Paraconic Acid; Pilosinic Acid; Tarconic Acid |
Molecular Formula | C5H6O4 |
Purity | ≥95% |
Storage | Store at room temperature |
IUPAC Name | 5-oxooxolane-3-carboxylic acid |
InChI | InChI=1S/C5H6O4/c6-4-1-3(2-9-4)5(7)8/h3H,1-2H2,(H,7,8) |
InChIKey | ONSWFYLALGXCIQ-UHFFFAOYSA-N |
SMILES | C1C(COC1=O)C(=O)O |