For research use only. Not for therapeutic Use.
(±)-Pinocembrin ((±)-5,7-Dihydroxyflavanone) is a GPR120 ligand able to promote wound healing in HaCaT cell line[1].
(±)-Pinocembrin shows wound-healing effect (EC50=0.07 µM), probably involves other mechanisms besides GPR120 activation[1].
| Catalog Number | R018916 |
| CAS Number | 68745-38-0 |
| Synonyms | 5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one |
| Molecular Formula | C15H12O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C15H12O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-7,13,16-17H,8H2 |
| InChIKey | URFCJEUYXNAHFI-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC=CC=C3 |
| Reference | [1]. Mazzotta S, et al. Pinocembrin and its linolenoyl ester derivative induce wound healing activity in HaCaT cell line potentially involving a GPR120/FFA4 mediated pathway. Bioorg Chem. 2021;108:104657. |
