For research use only. Not for therapeutic Use.
α-(Chloromethyl)-2,4-dichlorobenzyl alcohol is an organic compound featuring a benzyl alcohol core with a chloromethyl group at the alpha position and two chlorine atoms attached at the 2- and 4-positions of the benzene ring. This compound is primarily used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. The presence of multiple chlorine atoms increases its reactivity, making it useful in various substitution reactions for creating more complex molecules. It is valued in medicinal chemistry for its role in constructing bioactive compounds, particularly in the development of antimicrobial and antifungal agents.
CAS Number | 13692-14-3 |
Synonyms | 2,4-Dichloro-α-(chloromethyl)benzyl Alcohol; 2,4-Dichloro-α-chloromethylbenzenemethanol; 2-Chloro-1-(2,4-dichlorophenyl)ethanol?α-(2,4-Dichlorophenyl)-β-chloroethanol; |
Molecular Formula | C8H7Cl3O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-chloro-1-(2,4-dichlorophenyl)ethanol |
InChI | InChI=1S/C8H7Cl3O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3,8,12H,4H2 |
InChIKey | XHEPANNURIQWRM-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Cl)Cl)C(CCl)O |