α-Copaene(Cat No.:R033304)is a naturally occurring sesquiterpene hydrocarbon found in various essential oils, notably in the oils of copaiba, basil, and black pepper. It is characterized by its woody, spicy aroma and is widely used in the fragrance and flavor industries. In addition to its sensory properties, α-Copaene has been studied for its biological activities, including insect attractant and repellent effects, making it valuable in agricultural research for pest control strategies. Its high purity and consistency are essential for reliable results in both industrial applications and scientific studies.
Catalog Number | R033304 |
CAS Number | 3856-25-5 |
Synonyms | Copaene; 1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene; .alpha.-ylangene. |
Molecular Formula | C₁₅H₂₄ |
Purity | 95% |
Storage | -20°C |
IUPAC Name | (1R,2S,6S,7S,8S)-1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene |
InChI | InChI=1S/C15H24/c1-9(2)11-7-8-15(4)12-6-5-10(3)14(15)13(11)12/h5,9,11-14H,6-8H2,1-4H3/t11-,12-,13-,14+,15+/m0/s1 |
InChIKey | VLXDPFLIRFYIME-BTFPBAQTSA-N |
SMILES | CC1=CCC2C3C1C2(CCC3C(C)C)C |