β-Alanine-15N（Cat No.:S000622） is a stable isotope-labeled version of β-alanine, where the nitrogen atom is replaced with nitrogen-15 (15N). This specific labeling enhances its detection in scientific studies using mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy, enabling detailed tracking of β-alanine’s role in biological processes. β-Alanine is a non-essential amino acid important in the synthesis of carnosine, a dipeptide that acts as a buffering agent in muscles, reducing fatigue during high-intensity exercise. The use of β-Alanine-15N aids researchers in studying carnosine’s biosynthesis and its effects on muscle performance and endurance.
| Catalog Number | S000622 |
| CAS Number | 204451-53-6 |
| Molecular Formula | C3H715NO2 |
| Purity | 95% |
| IUPAC Name | 3-(15N)azanylpropanoic acid |
| InChI | InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6)/i4+1 |
| InChIKey | UCMIRNVEIXFBKS-AZXPZELESA-N |
| SMILES | C(CN)C(=O)O |
