For research use only. Not for therapeutic Use.
(-)-β-Bisabolene(Cat No.:R033366)is a naturally occurring sesquiterpene hydrocarbon found in the essential oils of various plants, including ginger and certain herbs. Known for its pleasant, sweet, and floral aroma, it is widely used in the fragrance and flavor industries. Additionally, (-)-β-Bisabolene has been studied for its potential anti-inflammatory, antimicrobial, and anticancer properties, making it valuable in pharmaceutical and cosmetic research. Its high purity and biological activity ensure consistent results in experimental applications, contributing to the development of natural therapeutics and enhancing the utility of essential oils in various industries.
CAS Number | 495-61-4 |
Synonyms | (S)-(-)-6-Methyl-2-(4-methyl-3-cyclohexen-1-yl)-1,5-heptadiene; (4S)-1-Methyl-4-(5-methyl-1-methylene-4-hexenyl)-cyclohexene; (S)-1-Methyl-4-(5-methyl-1-methylene-4-hexenyl)-cyclohexene; β-Bisabolene; (4S)-1-Methyl-4-(5-methyl-1-methylene-4-hexen-1-y |
Molecular Formula | C15H24 |
Purity | 85% |
Storage | -20°C |
IUPAC Name | (4S)-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexene |
InChI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8,15H,4-5,7,9-11H2,1-3H3/t15-/m1/s1 |
InChIKey | XZRVRYFILCSYSP-OAHLLOKOSA-N |
SMILES | CC1=CCC(CC1)C(=C)CCC=C(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |