For research use only. Not for therapeutic Use.
β-Cortolone(CAT: R060087) is a naturally occurring corticosteroid metabolite and a derivative of cortisol, primarily known for its role in steroid hormone metabolism research. As a significant intermediary in the corticosteroid metabolic pathway, β-Cortolone aids in studying adrenal gland function, inflammation, and stress responses. This compound is useful for biochemical and pharmacological research, particularly for developing insights into cortisol’s metabolic breakdown, potential therapeutic applications, and biomarker discovery in endocrine studies. β-Cortolone is valuable in advanced pharmacological research, supporting the study of corticosteroid pathways and potential therapeutic interventions for related disorders.
Catalog Number | R060087 |
CAS Number | 667-66-3 |
Synonyms | 3α,17,20β,21-Tetrahydroxy-11-pregnanone; 5β-Pregnan-11-one, 3α,17,20β,21-tetrahydroxy- (7CI,8CI); 20β-Cortolone; 20β-Hexahydrocortisone; 3α,17,20β,21-Tetrahydroxy-5β-pregnan-11-one; 3α,17α,20β,21-Tetrahydroxy-5β-pregnan-11-one; 5β-Pregnan-3α,17α,20β, |
Molecular Formula | C21H34O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (3R,5R,8S,9S,10S,13S,14S,17R)-17-[(1R)-1,2-dihydroxyethyl]-3,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
InChI | InChI=1S/C21H34O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h12-15,17-18,22-23,25-26H,3-11H2,1-2H3/t12-,13-,14+,15+,17-,18-,19+,20+,21+/m1/s1 |
InChIKey | JXCOSKURGJMQSG-AIEJOZITSA-N |
SMILES | CC12CCC(CC1CCC3C2C(=O)CC4(C3CCC4(C(CO)O)O)C)O |