For research use only. Not for therapeutic Use.
γ-Aminobutyric acid-d2 (Cat No.:S000621) is a deuterium-labeled version of γ-aminobutyric acid (GABA), where two hydrogen atoms are replaced with deuterium (D). GABA is the primary inhibitory neurotransmitter in the mammalian central nervous system, playing a crucial role in reducing neuronal excitability throughout the nervous system. The deuterium labeling of GABA enhances its stability and detection in spectroscopic studies such as nuclear magnetic resonance (NMR) and mass spectrometry. GABA-d2 is particularly useful for researching GABA’s regulatory mechanisms and its pharmacological properties in various neurological and psychological disorders.
CAS Number | 67910-98-9 |
Molecular Formula | C4H7D2NO2 |
Purity | ≥95% |
IUPAC Name | 4-amino-2,2-dideuteriobutanoic acid |
InChI | InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)/i2D2 |
InChIKey | BTCSSZJGUNDROE-CBTSVUPCSA-N |
SMILES | C(CC(=O)O)CN |