For research use only. Not for therapeutic Use.
(±)14(15)DiHET-d11 is a deuterated analog of 14(15)-DiHET, a dihydroxyeicosatrienoic acid metabolite derived from arachidonic acid through the cytochrome P450 enzyme pathway. This compound features eleven deuterium atoms, providing enhanced stability and precise isotopic labeling for advanced research applications. (±)14(15)DiHET-d11 is particularly valuable in studying the metabolism and biological activity of eicosanoids, including their role in inflammation, vascular biology, and signaling pathways. It is commonly used in pharmacokinetic studies, lipidomics, and isotope-dilution mass spectrometry. The isotopic labeling ensures accurate and reproducible measurements, making it a crucial tool for researchers investigating lipid metabolism, enzymatic pathways, and the therapeutic potential of eicosanoid-related compounds.
Synonyms | (±)14,15-DiHETrE-d11 |
Molecular Formula | C20H23D11O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (5Z,8Z,11Z,14R,15R)-16,16,17,17,18,18,19,19,20,20,20-undecadeuterio-14,15-dihydroxyicosa-5,8,11-trienoic acid |
InChI | InChI=1S/C20H34O4/c1-2-3-12-15-18(21)19(22)16-13-10-8-6-4-5-7-9-11-14-17-20(23)24/h4,6-7,9-10,13,18-19,21-22H,2-3,5,8,11-12,14-17H2,1H3,(H,23,24)/b6-4-,9-7-,13-10-/t18-,19+/m1/s1/i1D3,2D2,3D2,12D2,15D2 |
InChIKey | SYAWGTIVOGUZMM-LAOIBNNJSA-N |
SMILES | O[C@H]([C@H](O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])C/C=CC/C=CC/C=CCCCC(O)=O |