For research use only. Not for therapeutic Use.
(±)-2-Heptanol（Cat No.:R023025）is a chiral secondary alcohol with a seven-carbon chain, often used as a solvent and intermediate in organic synthesis. Its racemic mixture includes both enantiomers, which can serve various roles in the flavor and fragrance industries, imparting a mild, fruity odor. In research, (±)-2-Heptanol is useful for studying enantioselective reactions and biological activity related to chiral molecules. Its applications extend to the development of pharmaceuticals and agrochemicals, making it valuable in industrial and laboratory settings for creating complex organic compounds and exploring stereoisomer effects.
| Catalog Number | R023025 |
| CAS Number | 543-49-7 |
| Synonyms | 1-Methylhexanol; 2-Heptyl Alcohol; 2-Hydroxyheptane; Amyl Methyl Carbinol; DL-Heptan-2-ol; Methyl Amyl Carbinol; NSC 2220; s-Heptyl Alcohol; 2-Heptanol; |
| Molecular Formula | C7H16O |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | Store at RT |
| IUPAC Name | heptan-2-ol |
| InChI | InChI=1S/C7H16O/c1-3-4-5-6-7(2)8/h7-8H,3-6H2,1-2H3 |
| InChIKey | CETWDUZRCINIHU-UHFFFAOYSA-N |
| SMILES | CCCCCC(C)O |
