For research use only. Not for therapeutic Use.
(±)-Gossypol（Cat No.:I003062）is a polyphenolic compound derived from the seeds of the cotton plant (Gossypium species). Known for its potential anticancer properties, (±)-Gossypol acts as a BH3 mimetic, inhibiting the activity of anti-apoptotic proteins Bcl-2 and Bcl-xL, thereby inducing apoptosis in cancer cells. It has shown efficacy in treating various cancers, including prostate and breast cancer. Additionally, (±)-Gossypol exhibits antiviral, antifungal, and contraceptive properties. Its multifunctional nature and ability to target multiple pathways make (±)-Gossypol a promising candidate for further research in cancer therapy and other medical applications.
| Catalog Number | I003062 |
| CAS Number | 303-45-7 |
| Synonyms | 7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde |
| Molecular Formula | C₃₀H₃₀O₈ |
| Purity | ≥95% |
| Target | Bcl-2 Family |
| Solubility | DMF:25mg/ml;25 mM in DMSO; methanol:2 mg/ml; |
| Storage | Store at -20°C |
| IUPAC Name | 7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde |
| InChI | InChI=1S/C30H30O8/c1-11(2)19-15-7-13(5)21(27(35)23(15)17(9-31)25(33)29(19)37)22-14(6)8-16-20(12(3)4)30(38)26(34)18(10-32)24(16)28(22)36/h7-12,33-38H,1-6H3 |
| InChIKey | QBKSWRVVCFFDOT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C(C(=C2C(C)C)O)O)C=O)C(=C1C3=C(C4=C(C=C3C)C(=C(C(=C4C=O)O)O)C(C)C)O)O |
