For research use only. Not for therapeutic Use.
(±)-Levomepromazine-d6 is a high-purity deuterated compound used in advanced pharmaceutical and biochemical research. This isotopically labeled version of Levomepromazine is essential for studies involving antipsychotic drugs, pharmacokinetics, and metabolic pathways. Featuring six deuterium atoms, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for neuropharmacology research and drug development, (±)-Levomepromazine-d6 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S000032 |
| CAS Number | 1189805-51-3 |
| Molecular Formula | C19H18D6N2OS |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| IUPAC Name | 3-(2-methoxyphenothiazin-10-yl)-2-methyl-N,N-bis(trideuteriomethyl)propan-1-amine |
| InChI | InChI=1S/C19H24N2OS/c1-14(12-20(2)3)13-21-16-7-5-6-8-18(16)23-19-10-9-15(22-4)11-17(19)21/h5-11,14H,12-13H2,1-4H3/i2D3,3D3 |
| InChIKey | VRQVVMDWGGWHTJ-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])N(CC(C)CN1C2=CC=CC=C2SC3=C1C=C(C=C3)OC)C([2H])([2H])[2H] |
