For research use only. Not for therapeutic Use.
Levomepromazine（Cat No.:R045600）, also known as methotrimeprazine, is a phenothiazine derivative classified as a typical antipsychotic medication. It exhibits strong sedative, analgesic, and antiemetic properties, making it valuable in palliative care for managing pain, nausea, and agitation. The compound functions by antagonizing various central nervous system receptors, including dopaminergic, serotonergic, adrenergic, histaminergic, and muscarinic receptors. Common side effects encompass sedation, hypotension, dry mouth, and weight gain. Serious adverse effects may involve tardive dyskinesia, akathisia, cardiac arrhythmias, and neuroleptic malignant syndrome. Introduced in the 1950s, levomepromazine is marketed under brand names such as Nozinan, Levoprome, and Neurocil.
| CAS Number | 851-68-3 |
| Synonyms | 3-(2-methoxyphenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine |
| Molecular Formula | C19H24N2OS |
| Purity | ≥95% |
| IUPAC Name | 3-(2-methoxyphenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine |
| InChI | InChI=1S/C19H24N2OS/c1-14(12-20(2)3)13-21-16-7-5-6-8-18(16)23-19-10-9-15(22-4)11-17(19)21/h5-11,14H,12-13H2,1-4H3 |
| InChIKey | VRQVVMDWGGWHTJ-UHFFFAOYSA-N |
| SMILES | CC(CN1C2=CC=CC=C2SC3=C1C=C(C=C3)OC)CN(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
