For research use only. Not for therapeutic Use.
(±)-Methionine(Cat No.:R061698)is an essential sulfur-containing amino acid critical for protein synthesis and various metabolic processes. As a racemic mixture, it includes both D- and L-enantiomers, providing versatility in biochemical research and industrial applications. (±)-Methionine plays a vital role in methylation reactions as a precursor to S-adenosylmethionine (SAM), influencing epigenetic regulation and neurotransmitter synthesis. Additionally, it serves as a key dietary supplement and is used in the study of oxidative stress and cellular metabolism. Its high purity ensures reliability in experimental setups across multiple disciplines.
CAS Number | 59-51-8 |
Synonyms | Acimetion; Amurex; Banthionine; Cynaron; DL-2-Amino-4-(methylthio)butyric Acid; Dyprin; Lactet; Lobamine; Meonine; Meprom M 85; MetAMINO; Methilanin; MetiPEARL; Metione; NSC 9241; Neston; Pedameth; Racemethionine; Rhodimet NP 99; Smartamine; Smartami |
Molecular Formula | C5H11NO2S |
Purity | ≥95% |
Target | Parasite |
Storage | -20°C |
IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid |
InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
InChIKey | FFEARJCKVFRZRR-UHFFFAOYSA-N |
SMILES | CSCCC(C(=O)O)N |