For research use only. Not for therapeutic Use.
(±)-SDZ-201 106 is a diphenylpiperazinylindole derivative that prolongs the open state of cardiac voltage-gated Na (±)-SDZ-201 106 is also reported to act as an open-channel blocker of delayed-rectifier K
| Catalog Number | R066961 |
| CAS Number | 97730-95-5 |
| Synonyms | DPI 201-106 |
| Molecular Formula | C29H30N4O2 |
| Purity | ≥95% |
| Target | Sodium Channel |
| Storage | -20°C |
| IUPAC Name | 4-[3-(4-benzhydrylpiperazin-1-yl)-2-hydroxypropoxy]-1H-indole-2-carbonitrile |
| InChI | InChI=1S/C29H30N4O2/c30-19-24-18-26-27(31-24)12-7-13-28(26)35-21-25(34)20-32-14-16-33(17-15-32)29(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-13,18,25,29,31,34H,14-17,20-21H2 |
| InChIKey | BYBYHCOEAFHGJL-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC(COC2=CC=CC3=C2C=C(N3)C#N)O)C(C4=CC=CC=C4)C5=CC=CC=C5 |
| Reference | 1.Kaumann, A.H.,Richards, D.E. and Russell, D.A. Inhibition of the sodium pump by cardioactive DPI 201-106. Br. J. Pharmacol. 91(1), 3-5 (1987). |
