For research use only. Not for therapeutic Use.
(±)-Sigmoidin A（Cat No.:I042267）is a naturally occurring compound isolated from Cynanchum species, known for its unique chemical structure and potential biological activities. It is a member of the pyrrolidine alkaloid family and has shown promise in various pharmacological studies. Research suggests that (±)-Sigmoidin A may possess anticancer, antimicrobial, and anti-inflammatory properties. Its biological effects are thought to be linked to its ability to modulate key signaling pathways involved in cell growth, inflammation, and immune response. Ongoing studies are investigating its potential as a lead compound for drug development in various therapeutic areas.
| Catalog Number | I042267 |
| CAS Number | 176046-04-1 |
| Synonyms | 2-[3,4-dihydroxy-2,5-bis(3-methylbut-2-enyl)phenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| Molecular Formula | C25H28O6 |
| Purity | ≥95% |
| IUPAC Name | 2-[3,4-dihydroxy-2,5-bis(3-methylbut-2-enyl)phenyl]-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C25H28O6/c1-13(2)5-7-15-9-18(17(8-6-14(3)4)25(30)24(15)29)21-12-20(28)23-19(27)10-16(26)11-22(23)31-21/h5-6,9-11,21,26-27,29-30H,7-8,12H2,1-4H3 |
| InChIKey | BVHLNRAYBCPKOY-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=CC(=C(C(=C1O)O)CC=C(C)C)C2CC(=O)C3=C(C=C(C=C3O2)O)O)C |
