For research use only. Not for therapeutic Use.
(±)-Strigol(CAT: H000077) is a chemical compound of interest in the field of plant biology and agronomy. Strigolactones are a class of plant hormones, and (±)-strigol is one of the naturally occurring strigolactone isomers. These compounds play a crucial role in various plant processes, including seed germination, root development, and interactions with symbiotic fungi (mycorrhizae).
| Catalog Number | H000077 |
| CAS Number | 51820-11-2 |
| Synonyms | (3aR*,5S*,8bS*,2/’R*)-3-[(E)-2/’,5/’-dihydro-4/’-methyl-5/’-oxo-2/’-furanyloxymethylene]-5-hydroxy-8,8-dimethyl-3,3a,4,5,6,7,8,8b-octahydroindeno[1,2-b]furan-2-one |
| Molecular Formula | C19H22O6 |
| Purity | ≥95% |
| Storage | Store at 0-8 °C |
| IUPAC Name | (3aR,5S,8bS)-5-hydroxy-8,8-dimethyl-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-3a,4,5,6,7,8b-hexahydroindeno[1,2-b]furan-2-one |
| InChI | InChI=1S/C19H22O6/c1-9-6-14(24-17(9)21)23-8-12-10-7-11-13(20)4-5-19(2,3)15(11)16(10)25-18(12)22/h6,8,10,13-14,16,20H,4-5,7H2,1-3H3/t10-,13+,14-,16+/m1/s1 |
| InChIKey | VOFXXOPWCBSPAA-FTOGJNOLSA-N |
| SMILES | CC1=CC(OC1=O)OC=C2C3CC4=C(C3OC2=O)C(CCC4O)(C)C |
| Reference | 1: Humphrey AJ, Beale MH. Strigol: biogenesis and physiological activity. 2: Yasuda N, Sugimoto Y, Kato M, Inanaga S, Yoneyama K. (+)-Strigol, a witchweed |
