For research use only. Not for therapeutic Use.
(±)-Thalidomide（Cat No.:A000994）is a racemic mixture of the drug thalidomide, known for its immunomodulatory, anti-inflammatory, and anti-angiogenic properties. Initially developed as a sedative, it gained infamy for causing birth defects. Today, thalidomide is used to treat multiple myeloma and complications of leprosy. It works by inhibiting tumor necrosis factor-alpha (TNF-α) and angiogenesis, as well as modulating the immune response. Despite its past, thalidomide has proven therapeutic benefits under strict controls, offering effective treatment for specific cancers and chronic inflammatory conditions.
| Catalog Number | A000994 |
| CAS Number | 50-35-1 |
| Synonyms | 50-35-1; Thalomid; Sedoval; (+/-)-THALIDOMIDE; 2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione |
| Molecular Formula | C₁₃H₁₀N₂O₄ |
| Purity | ≥95% |
| Target | TNF-α |
| Solubility | >11.8mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChI | InChI=1S/C13H10N2O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19/h1-4,9H,5-6H2,(H,14,16,17) |
| InChIKey | UEJJHQNACJXSKW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=CC=CC=C3C2=O |
