For research use only. Not for therapeutic Use.
(±)-Vasicine（Cat No.:R021727） is the racemic mixture of Vasicine, a natural alkaloid isolated from the seeds of Peganum harmala. Vasicine has demonstrated potent inhibitory effects on the activity of H+-K+-ATPase with an IC50 of 73.47 μg/mL, making it valuable in treating acid-related disorders like ulcers. Additionally, Vasicine exhibits significant antisecretory, antioxidant, and cytoprotective properties, which contribute to its antiulcer activity. Its multifaceted pharmacological effects make it a promising candidate for further research and potential therapeutic applications in gastrointestinal and antioxidant therapies.
| Catalog Number | R021727 |
| CAS Number | 6159-56-4 |
| Synonyms | 1,2,3,9-Tetrahydro-pyrrolo[2,1-b]quinazolin-3-ol; (±)-Linarine; (±)-Peganine;DL-Vasicine; dl-Peganine; dl-Vasicine |
| Molecular Formula | C11H12N2O |
| Purity | ≥95% |
| Target | Proton Pump |
| Storage | -20°C |
| IUPAC Name | 1,2,3,9-tetrahydropyrrolo[2,1-b]quinazolin-3-ol |
| InChI | InChI=1S/C11H12N2O/c14-10-5-6-13-7-8-3-1-2-4-9(8)12-11(10)13/h1-4,10,14H,5-7H2 |
| InChIKey | YIICVSCAKJMMDJ-UHFFFAOYSA-N |
| SMILES | C1CN2CC3=CC=CC=C3N=C2C1O |
