For research use only. Not for therapeutic Use.
α,α’-Dichloro-p-xylene(CAT: R070449) is an organic compound commonly used as an intermediate in the synthesis of various chemical products, including pharmaceuticals, agrochemicals, and specialty chemicals. This compound features two chlorine atoms attached to the methyl groups of a p-xylene backbone, making it highly reactive and suitable for further chemical transformations. α,α’-Dichloro-p-xylene is particularly valuable in the production of polymers, dyes, and other fine chemicals where its structure can be exploited to introduce specific functional groups or to serve as a cross-linking agent. Researchers and chemists utilize this compound for its versatility and reactivity in developing new materials and in the synthesis of complex molecular structures.
CAS Number | 623-25-6 |
Synonyms | 1.4-Bis(chloromethyl)benzene |
Molecular Formula | C8H8Cl2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 1,4-bis(chloromethyl)benzene |
InChI | InChI=1S/C8H8Cl2/c9-5-7-1-2-8(6-10)4-3-7/h1-4H,5-6H2 |
InChIKey | ZZHIDJWUJRKHGX-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CCl)CCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |