For research use only. Not for therapeutic Use.
α-(2,3-Dimethylphenyl)-α-methyl-1H-imidazole-5-methanol(Cat No.:R032569), is a complex organic compound with a specific molecular structure. It belongs to the class of imidazole derivatives and is used in medicinal and pharmaceutical research. This compound’s intricate name denotes the positions and types of various chemical groups within its structure, aiding in its identification and study.
CAS Number | 86347-12-8 |
Synonyms | α-(2,3-Dimethylphenyl)-α-methyl-1H-imidazole-4-methanol; Hydroxymedetomidine |
Molecular Formula | C13H16N2O |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1-(2,3-dimethylphenyl)-1-(1H-imidazol-5-yl)ethanol |
InChI | InChI=1S/C13H16N2O/c1-9-5-4-6-11(10(9)2)13(3,16)12-7-14-8-15-12/h4-8,16H,1-3H3,(H,14,15) |
InChIKey | LBUFLYABQRDXQB-UHFFFAOYSA-N |
SMILES | CC1=C(C(=CC=C1)C(C)(C2=CN=CN2)O)C |