For research use only. Not for therapeutic Use.
α-(4-Bromophenyl)-2-pyridineacetonitrile is an organic compound featuring a bromophenyl group and a pyridine ring connected via an acetonitrile group. This versatile molecule is widely used as an intermediate in the synthesis of complex organic compounds, particularly in pharmaceuticals and agrochemicals. Its bromine atom allows for further functionalization through cross-coupling reactions, while the nitrile group adds reactivity for various chemical transformations. This compound is valuable for developing bioactive molecules and serves as a key building block in drug discovery research.
CAS Number | 85750-24-9 |
Molecular Formula | C13H9BrN2 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 2-(4-bromophenyl)-2-pyridin-2-ylacetonitrile |
InChI | InChI=1S/C13H9BrN2/c14-11-6-4-10(5-7-11)12(9-15)13-3-1-2-8-16-13/h1-8,12H |
InChIKey | PMKCUNAECONNCQ-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)C(C#N)C2=CC=C(C=C2)Br |