For research use only. Not for therapeutic Use.
α-Ketobutyric acid(Cat No.:R012152)is a four-carbon keto acid with a keto group at the alpha position relative to the carboxyl group. This compound plays a crucial role in various metabolic pathways, including the synthesis of amino acids like cysteine and methionine. It serves as an intermediate in the catabolism of threonine and the metabolism of propionyl-CoA. In biochemical research, α-Ketobutyric acid is used to study metabolic processes and enzyme functions. Its versatile role in metabolism makes it essential for research in biochemistry and medical studies.
CAS Number | 600-18-0 |
Synonyms | 2-Oxobutanoic Acid; 2-Oxobutyric Acid; 2-Ketobutanoic Acid; 2-Ketobutyric Acid; 2-Oxo-n-butyric Acid; 2-Oxobutanoic Acid; 2-Oxobutyric Acid; 3-Methylpyruvic Acid; NSC 60533; Propionylformic Acid; α-Ketobutyric Acid; α-Oxo-n-butyric Acid; α-Oxobutanoi |
Molecular Formula | C4H6O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 2-oxobutanoic acid |
InChI | InChI=1S/C4H6O3/c1-2-3(5)4(6)7/h2H2,1H3,(H,6,7) |
InChIKey | TYEYBOSBBBHJIV-UHFFFAOYSA-N |
SMILES | CCC(=O)C(=O)O |