For research use only. Not for therapeutic Use.
α-Monomyristin（Cat No.:R022479）is a naturally occurring monoglyceride derived from myristic acid, primarily found in nutmeg. With its unique molecular structure, it serves as a versatile intermediate in biochemical and pharmaceutical applications. α-Monomyristin exhibits potential as a skin-conditioning agent and emollient, making it valuable in cosmetics and topical formulations. In research, it is often used to study lipid metabolism and as a reference compound in lipid analysis. Its stable and efficient properties make α-Monomyristin a reliable component for various scientific and industrial applications.
| Catalog Number | R022479 |
| CAS Number | 589-68-4 |
| Synonyms | Tetradecanoic Acid 2,3-Dihydroxypropyl Ester; (±)-2,3-Dihydroxypropyl Tetradecanoate; 1-Monomyristin; 1-Monomyristoyl-rac-glycerol; 1-Monotetradecanoylglycerol; Glycerol 1-monotetradecanoate; Glycerol 1-Myristate; Glycerol α-Monomyristate; Glyceryl M |
| Molecular Formula | C17H34O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,3-dihydroxypropyl tetradecanoate |
| InChI | InChI=1S/C17H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(20)21-15-16(19)14-18/h16,18-19H,2-15H2,1H3 |
| InChIKey | DCBSHORRWZKAKO-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCCC(=O)OCC(CO)O |
