For research use only. Not for therapeutic Use.
α-Toxicarol is a naturally occurring rotenoid compound extracted from the roots of certain Derris species. It is known for its insecticidal and piscicidal properties, traditionally used in agriculture and fishing. α-Toxicarol acts by inhibiting mitochondrial electron transport, leading to cellular energy depletion in targeted pests. Besides its pesticidal use, it is studied for potential therapeutic properties, including anti-cancer and anti-inflammatory effects. However, its toxicity to non-target organisms necessitates careful handling and application.
CAS Number | 82-09-7 |
Molecular Formula | C23H22O7 |
Purity | ≥95% |
Storage | -20°C |
InChI | InChI=1S/C23H22O7/c1-23(2)6-5-11-15(30-23)8-13(24)20-21(25)19-12-7-16(26-3)17(27-4)9-14(12)28-10-18(19)29-22(11)20/h5-9,18-19,24H,10H2,1-4H3/t18-,19+/m1/s1 |
InChIKey | JLTNCZQNGBLBGO-MOPGFXCFSA-N |
SMILES | CC1(C=CC2=C3C(=C(C=C2O1)O)C(=O)C4C(O3)COC5=CC(=C(C=C45)OC)OC)C |