For research use only. Not for therapeutic Use.
α-Zearalenol is a mycotoxin produced by certain fungi, primarily found in contaminated grains and feeds. This estrogenic compound is a metabolite of zearalenone and is known for its potent endocrine-disrupting properties. It can interfere with reproductive hormone functions in animals, leading to various health issues, including reproductive disorders and reduced fertility. Due to its significant impact on livestock, α-Zearalenol is a subject of concern in food safety and agricultural practices, prompting ongoing research into its effects and mitigation strategies.
CAS Number | 36455-72-8 |
Synonyms | (3S,7R,11E)-3,4,5,6,7,8,9,10-Octahydro-7,14,16-trihydroxy-3-methyl-1H-2-benzoxacyclotetradecin-1-one; (-)-α-Zearalenol; Zearalenol; trans-Zearalenol; ? |
Molecular Formula | C18H24O5 |
Purity | ≥95% |
Target | Estrogen Receptor/ERR |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
InChI | 1S/C18H24O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h3,7,10-12,14,19-21H,2,4-6,8-9H2,1H3/b7-3+/t12-,14+/m0/s1 |
InChIKey | FPQFYIAXQDXNOR-QDKLYSGJSA-N |
SMILES | C[C@H]1CCC[C@@H](CCC/C=C/C2=C(C(=CC(=C2)O)O)C(=O)O1)O |