For research use only. Not for therapeutic Use.
(αR)-α-Methyl-N-[(1R)-1-phenylethyl]benzenemethanamine Hydrochloride(CAT: R018975) is a chiral amine used in pharmaceutical research and synthesis. This compound, characterized by its specific stereochemistry, plays a crucial role in the development of enantiomerically pure drugs. Its structure features a phenylethyl group and a benzenemethanamine backbone, making it suitable for use as an intermediate in the production of various pharmaceutical agents. The hydrochloride salt form enhances its solubility and stability, making it easier to handle in laboratory settings. This compound is particularly valuable in the study of asymmetric synthesis and the development of novel therapeutic agents.
CAS Number | 82398-30-9 |
Synonyms | Bis((1R)-1-phenylethyl)amine Hydrochloride; [R-(R*,R*)]-α-Methyl-N-(1-phenylethyl)-Benzenemethanamine Hydrochloride; |
Molecular Formula | C16H20ClN |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (1R)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine;hydrochloride |
InChI | InChI=1S/C16H19N.ClH/c1-13(15-9-5-3-6-10-15)17-14(2)16-11-7-4-8-12-16;/h3-14,17H,1-2H3;1H/t13-,14-;/m1./s1 |
InChIKey | ZBQCLJZOKDRAOW-DTPOWOMPSA-N |
SMILES | C[C@H](C1=CC=CC=C1)N[C@H](C)C2=CC=CC=C2.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |