Home
>
Reference Standards> (αS,3S)-α-[(tert-Butyloxycarbonyl)amino]-2-oxo-3-pyrrolidinepropanoic acid Methyl Ester
For research use only. Not for therapeutic Use.
(αS,3S)-α-[(tert-Butyloxycarbonyl)amino]-2-oxo-3-pyrrolidinepropanoic acid methyl ester(Cat No.:R040270)is a chiral building block commonly used in peptide synthesis and medicinal chemistry. Featuring a tert-butyloxycarbonyl (Boc) protected amino group, this compound ensures stability during synthetic processes. Its methyl ester functional group allows for easy incorporation into peptide chains, making it a valuable intermediate in the synthesis of complex peptides and pharmaceuticals. This compound’s stereochemistry and protective groups facilitate the development of various bioactive molecules, contributing to advancements in drug discovery and development.
CAS Number | 328086-60-8 |
Synonyms | (αS,3S)-α-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-oxo-3-pyrrolidinepropanoic acid Methyl Ester |
Molecular Formula | C13H22N2O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate |
InChI | InChI=1S/C13H22N2O5/c1-13(2,3)20-12(18)15-9(11(17)19-4)7-8-5-6-14-10(8)16/h8-9H,5-7H2,1-4H3,(H,14,16)(H,15,18)/t8-,9-/m0/s1 |
InChIKey | HTQMBOWAEPNWLI-IUCAKERBSA-N |
SMILES | CC(C)(C)OC(=O)NC(CC1CCNC1=O)C(=O)OC |