For research use only. Not for therapeutic Use.
β-Amyrone(Cat No.:R017518)is a naturally occurring pentacyclic triterpenoid commonly found in various plant species. Derived from the more widely recognized triterpene β-amyrin through oxidative processes, it possesses a characteristic oleanane-type skeleton. This compound is often isolated from the surface waxes and resins of leaves, bark, or fruits. Preliminary research suggests that β-amyrone may exhibit potential pharmacological activities, including antioxidant, anti-inflammatory, and antimicrobial effects. Its presence can serve as a chemical marker in chemotaxonomic studies, helping to differentiate and classify related plant species. Its potential medicinal applications remain areas of ongoing research.
Catalog Number | R017518 |
CAS Number | 638-97-1 |
Molecular Formula | C30H48O |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (4aR,6aR,6bS,8aR,12aR,14aR,14bR)-4,4,6a,6b,8a,11,11,14b-octamethyl-2,4a,5,6,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picen-3-one e |
InChI | InChI=1S/C30H48O/c1-25(2)15-16-27(5)17-18-29(7)20(21(27)19-25)9-10-23-28(6)13-12-24(31)26(3,4)22(28)11-14-30(23,29)8/h9,21-23H,10-19H2,1-8H3/t21-,22-,23+,27+,28-,29+,30+/m0/s1 |
InChIKey | LIIFBMGUDSHTOU-CFYIDONUSA-N |
SMILES | C[C@@]12CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCC(=O)C5(C)C)C)C)[C@@H]1CC(CC2)(C)C)C |