For research use only. Not for therapeutic Use.
β-Citraurin(Cat No.:R066557), is a naturally occurring organic compound primarily found in citrus fruits like oranges, lemons, and grapefruits. It is responsible for the vibrant orange and yellow colors in these fruits. β-Citraurin is a carotenoid pigment, part of the larger carotenoid family, known for its antioxidant properties and potential health benefits. It acts as a natural pigment and antioxidant, contributing to the fruit’s visual appeal and nutritional value. Carotenoids like β-Citraurin are believed to have health-promoting effects due to their role in neutralizing harmful free radicals in the body, potentially reducing the risk of certain chronic diseases.
Catalog Number | R066557 |
CAS Number | 650-69-1 |
Synonyms | (3R)‐3‐Hydroxy‐8’‐apo‐β‐caroten‐8’‐al |
Molecular Formula | C30H40O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2E,4E,6E,8E,10E,12E,14E,16E)-17-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-2,6,11,15-tetramethylheptadeca-2,4,6,8,10,12,14,16-octaenal |
InChI | InChI=1S/C30H40O2/c1-23(12-8-9-13-24(2)15-11-17-26(4)22-31)14-10-16-25(3)18-19-29-27(5)20-28(32)21-30(29,6)7/h8-19,22,28,32H,20-21H2,1-7H3/b9-8+,14-10+,15-11+,19-18+,23-12+,24-13+,25-16+,26-17+/t28-/m1/s1 |
InChIKey | AVPAEFHIEZLSLZ-QCPGYTKSSA-N |
SMILES | CC1=C(C(CC(C1)O)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=O)C)C |