For research use only. Not for therapeutic Use.
β-Hederin(CAT: R066037) is a naturally occurring triterpenoid saponin commonly found in plants like ivy (Hedera species). It possesses various biological activities and has attracted attention for its potential medicinal uses. β-Hederin is known for its cytotoxic properties, making it a subject of interest in cancer research. It has been studied for its ability to induce cell death and inhibit the proliferation of cancer cells. Furthermore, β-Hederin has been investigated for its anti-inflammatory and immunomodulatory effects, suggesting potential applications in conditions related to immune system dysfunction.
Catalog Number | R066037 |
CAS Number | 35790-95-5 |
Molecular Formula | C41H66O11 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
InChI | InChI=1S/C41H66O11/c1-21-28(43)30(45)31(46)33(50-21)52-32-29(44)24(42)20-49-34(32)51-27-12-13-38(6)25(37(27,4)5)11-14-40(8)26(38)10-9-22-23-19-36(2,3)15-17-41(23,35(47)48)18-16-39(22,40)7/h9,21,23-34,42-46H,10-20H2,1-8H3,(H,47,48)/t21-,23-,24-,25-,26+,27-,28-,29-,30+,31+,32+,33-,34-,38-,39+,40+,41-/m0/s1 |
InChIKey | IBAJNOZMACNWJD-HVUPOBLPSA-N |
SMILES | CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC4(C(C3(C)C)CCC5(C4CC=C6C5(CCC7(C6CC(CC7)(C)C)C(=O)O)C)C)C)O)O)O)O)O |