For research use only. Not for therapeutic Use.
β-Hydroxypropiovanillone is an organic compound featuring a hydroxyl group and a vanillone structure, commonly used in pharmaceutical and biochemical research. It is a derivative of vanillin, with a hydroxyl group at the beta position of the carbon chain. This compound is often studied for its potential antioxidant, anti-inflammatory, and antimicrobial properties. Additionally, β-Hydroxypropiovanillone serves as a valuable intermediate in the synthesis of more complex bioactive molecules, contributing to advancements in medicinal chemistry and drug development.
CAS Number | 2196-18-1 |
Synonyms | 1-Propanone, 3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-; Propiophenone, 3,4′-dihydroxy-3′-methoxy-; 3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-1-one |
Molecular Formula | C10H12O4 |
Purity | ≥95% |
Storage | 3 years -20C powder |
IUPAC Name | 3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-1-one |
InChI | InChI=1S/C10H12O4/c1-14-10-6-7(2-3-9(10)13)8(12)4-5-11/h2-3,6,11,13H,4-5H2,1H3 |
InChIKey | NXCPMSUBVRGTSE-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)C(=O)CCO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |