For research use only. Not for therapeutic Use.
β-Naphthoflavone-CH₂-Br (CAT: I016921) is a derivative of β-naphthoflavone, functioning as a ligand for the aryl hydrocarbon receptor (AhR). By binding to AhR, it modulates transcriptional activity, influencing the expression of xenobiotic-metabolizing enzymes such as cytochrome P450s (e.g., CYP1A1). β-NF-CH₂-Br is widely used in research to study AhR signaling pathways, xenobiotic metabolism, and the role of AhR in toxicology and immune responses. Its structural modification with a bromomethyl group enhances its utility in probing receptor-ligand interactions and in the development of AhR-targeted therapeutic and environmental studies.
| Catalog Number | I016921 |
| CAS Number | 1282513-77-2 |
| Molecular Formula | C₂₀H₁₃BrO₂ |
| Purity | ≥95% |
| IUPAC Name | 3-[4-(bromomethyl)phenyl]benzo[f]chromen-1-one |
| InChI | InChI=1S/C20H13BrO2/c21-12-13-5-7-15(8-6-13)19-11-17(22)20-16-4-2-1-3-14(16)9-10-18(20)23-19/h1-11H,12H2 |
| InChIKey | JKXPXUCDLPRQNA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C(=O)C=C(O3)C4=CC=C(C=C4)CBr |
