For research use only. Not for therapeutic Use.
β-NPP, or N, N’-di(naphthalene-2-yl)-N, N’-diphenylbenzene-1,4-diamine（Cat No.:M126986）, is a chemical compound used as a hole-transporting material in organic electronic devices, such as organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs). It is known for its high thermal stability and excellent charge transport properties, making it a suitable material for improving the efficiency and longevity of such devices. β-NPP has been studied extensively for its potential applications in optoelectronic devices, where its unique molecular structure and electronic properties contribute to enhancing device performance.
| CAS Number | 139994-47-1 |
| Molecular Formula | C38H28N2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-N,4-N-dinaphthalen-2-yl-1-N,4-N-diphenylbenzene-1,4-diamine |
| InChI | InChI=1S/C38H28N2/c1-3-15-33(16-4-1)39(37-21-19-29-11-7-9-13-31(29)27-37)35-23-25-36(26-24-35)40(34-17-5-2-6-18-34)38-22-20-30-12-8-10-14-32(30)28-38/h1-28H |
| InChIKey | QVDYERLGSGAPKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)N(C3=CC=CC=C3)C4=CC5=CC=CC=C5C=C4)C6=CC7=CC=CC=C7C=C6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
