For research use only. Not for therapeutic Use.
β-Pseudouridine is a naturally occurring nucleoside, an isomer of uridine, found in various types of RNA, including tRNA, rRNA, and snRNA. It is unique due to its C-C glycosidic bond, which enhances RNA stability and function. β-Pseudouridine plays a critical role in the proper folding and structural integrity of RNA molecules, influencing processes such as translation and splicing. Its incorporation into synthetic mRNA has gained attention for improving mRNA-based therapeutics’ stability and translational efficiency, making it a valuable component in biotechnology and medical research.
| Catalog Number | R053700 |
| CAS Number | 1445-07-4 |
| Synonyms | 5-β-D-Ribofuranosyl-2,4(1H,3H)-Pyrimidinedione; 5-(β-D-Ribofuranosyl)uracil; 5-Ribosyluracil; NSC 162405; Pseudouridine C; β-D-Pseudouridine; Pseudouridine; ψ-Uridine; |
| Molecular Formula | C9H12N2O6 |
| Purity | ≥95% |
| Target | Cell Cycle/DNA Damage |
| Storage | -20°C |
| IUPAC Name | 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione |
| InChI | InChI=1S/C9H12N2O6/c12-2-4-5(13)6(14)7(17-4)3-1-10-9(16)11-8(3)15/h1,4-7,12-14H,2H2,(H2,10,11,15,16)/t4-,5-,6-,7+/m1/s1 |
| InChIKey | PTJWIQPHWPFNBW-GBNDHIKLSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1)C2C(C(C(O2)CO)O)O |
