For research use only. Not for therapeutic Use.
γ-Carotene(CAT: R066551) is a naturally occurring carotenoid found in various fruits and vegetables, contributing to their vibrant orange and yellow colors. Structurally similar to β-carotene, γ-carotene serves as a precursor to other essential carotenoids and can be converted into vitamin A in the human body. This compound plays a crucial role in protecting cells from oxidative damage, thanks to its antioxidant properties. Research has highlighted its potential health benefits, including supporting vision, immune function, and reducing the risk of chronic diseases like cardiovascular conditions and certain cancers. γ-Carotene is also explored for its applications in functional foods and dietary supplements.
| Catalog Number | R066551 |
| CAS Number | 472-93-5 |
| Molecular Formula | C40H56 |
| Purity | ≥95% |
| Storage | 20°C |
| IUPAC Name | 2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,13,15,17,19,23-undecaenyl]-1,3,3-trimethylcyclohexene |
| InChI | InChI=1S/C40H56/c1-32(2)18-13-21-35(5)24-15-26-36(6)25-14-22-33(3)19-11-12-20-34(4)23-16-27-37(7)29-30-39-38(8)28-17-31-40(39,9)10/h11-12,14-16,18-20,22-27,29-30H,13,17,21,28,31H2,1-10H3/b12-11+,22-14+,23-16+,26-15+,30-29+,33-19+,34-20+,35-24+,36-25+,37-27+ |
| InChIKey | HRQKOYFGHJYEFS-BXOLYSJBSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C)C)C |
