For research use only. Not for therapeutic Use.
γ-Aminobutyric Acid-d6 (GABA-d6) （Cat No.:R014996）is a deuterated version of GABA, a key neurotransmitter inhibiting nerve transmission in the brain, crucial for preventing overexcitement. Featuring six deuterium atoms, this compound offers enhanced spectral resolution in NMR spectroscopy, making it invaluable for neurochemical research and the study of GABAergic mechanisms. GABA-d6 is essential in pharmaceutical development, particularly for designing drugs that modulate synaptic transmission. Its use in metabolic labeling studies helps in understanding the biosynthesis and degradation of GABA, thereby contributing to advanced neurological and psychiatric research.
| Catalog Number | R014996 |
| CAS Number | 70607-85-1 |
| Synonyms | 4-Aminobutanoic-2,2,3,3,4,4-d6 Acid; 4-Aminobutanoic Αcid-d6; 3-Carboxypropylamine-d6; 4-Aminobutyric Acid-d6; Aminalon-d6; GABA-d6; Gaballon-d6; Gamarex-d6; Gammalon-d6; Gammalone-d6; Gammar-d6; Gammasol-d6; Mielogen-d6; Mielomade-d6; NSC 27418-d6; |
| Molecular Formula | C4H9NO2 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | 4-amino-2,2,3,3,4,4-hexadeuteriobutanoic acid |
| InChI | InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)/i1D2,2D2,3D2 |
| InChIKey | BTCSSZJGUNDROE-NMFSSPJFSA-N |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])N |
