For research use only. Not for therapeutic Use.
1-Adrenosterone(Cat No.:R023635)is a steroid hormone and a potent inhibitor of the enzyme 11β-hydroxysteroid dehydrogenase type 1 (11β-HSD1). It plays a significant role in regulating cortisol levels in the body, making it valuable for research in metabolic disorders, obesity, and related conditions. This compound also finds applications in the study of adrenal gland function and hormone synthesis. High-purity 1-Adrenosterone is essential for researchers aiming to develop novel therapies and gain deeper insights into steroid hormone regulation and metabolic health.
CAS Number | 7738-93-4 |
Synonyms | Androsta-1,4-diene-3,11,17-trione; NSC 82849 |
Molecular Formula | C19H22O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (8S,9S,10R,13S,14S)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11,17-trione |
InChI | InChI=1S/C19H22O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h7-9,13-14,17H,3-6,10H2,1-2H3/t13-,14-,17+,18-,19-/m0/s1 |
InChIKey | RZACPWSZIQKVDY-IRIMSJTPSA-N |
SMILES | CC12CC(=O)C3C(C1CCC2=O)CCC4=CC(=O)C=CC34C |