For research use only. Not for therapeutic Use.
ε-(γ-L-Glutamyl)lysine is a cross-linking amino acid important in biochemical research. It serves as a marker for protein-protein interactions and enzymatic activity studies. This compound is essential for investigating protein structures, understanding cellular functions, and exploring enzymatic pathways, providing precise and reliable results in advanced scientific research.
Catalog Number | R017267 |
CAS Number | 17105-15-6 |
Synonyms | Nε(γ-Glutamyl)lysine; Nε-(γ-Glutamyl)-L-lysine; γ-Glutamyl-ε-lysine; ε-(L-γ-Glutamyl)-L-lysine; ε-(γ-Glutamyl)lysine; ε-(γ-L-Glutamyl)-L-lysine; εN-(γ-L-Glutamyl)lysine; L-N6-L-γ-Glutamyllysine; |
Molecular Formula | C11H21N3O5 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-6-[[(4S)-4-amino-4-carboxybutanoyl]amino]hexanoic acid |
InChI | InChI=1S/C11H21N3O5/c12-7(10(16)17)3-1-2-6-14-9(15)5-4-8(13)11(18)19/h7-8H,1-6,12-13H2,(H,14,15)(H,16,17)(H,18,19)/t7-,8-/m0/s1 |
InChIKey | JPKNLFVGUZRHOB-YUMQZZPRSA-N |
SMILES | C(CCNC(=O)CCC(C(=O)O)N)CC(C(=O)O)N |