For research use only. Not for therapeutic Use.
ζ-Carotene(CAT: R066555) is an intermediate carotenoid in the biosynthetic pathway of β-carotene and other essential carotenoids in plants. It is found in the chloroplasts of green plants, contributing to the overall process of photosynthesis. ζ-Carotene is a colorless compound that plays a crucial role in the synthesis of pigments responsible for the vibrant colors in fruits and vegetables, such as lycopene and β-carotene. Though it is not a major dietary carotenoid, its presence is vital for the production of carotenoids that can be converted into vitamin A, essential for vision, immune function, and overall health. ζ-Carotene is also studied for its role in plant biology and its potential implications in improving crop nutrition.
Catalog Number | R066555 |
CAS Number | 72746-33-9 |
Synonyms | 7,8,7’,8’‐Tetrahydro‐ψ,ψ‐carotene |
Molecular Formula | C40H60 |
Purity | ≥95% |
Storage | 20°C |
IUPAC Name | (6E,10Z,12E,14E,16E,18E,20E,22Z,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,12,14,16,18,20,22,26,30-undecaene |
InChI | InChI=1S/C40H60/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-16,19-22,25-30H,13-14,17-18,23-24,31-32H2,1-10H3/b12-11+,25-15+,26-16+,35-21+,36-22+,37-27+,38-28+,39-29-,40-30- |
InChIKey | BIWLELKAFXRPDE-ZURBLSRNSA-N |
SMILES | CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C)C=CC=C(C)CCC=C(C)CCC=C(C)C)C)C)C)C |